C3H3F3N3Na — CID 175347960
sodium;hydride;5-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 175347960) has the molecular formula C3H3F3N3Na and a molecular weight of 161.06 g/mol. Its IUPAC name is sodium;hydride;5-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | sodium;hydride;5-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 175347960 |
| Molecular Formula | C3H3F3N3Na |
| Molecular Weight | 161.06 g/mol |
| Exact Mass | 161.02 |
| IUPAC Name | sodium;hydride;5-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | FC(F)(F)c1ncn[nH]1.[H-].[Na+] |
| InChI | InChI=1S/C3H2F3N3.Na.H/c4-3(5,6)2-7-1-8-9-2;;/h1H,(H,7,8,9);;/q;+1;-1 |
| InChIKey | HIABFIWLOHTICO-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.06 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |