C6H2F9N3 — CID 172853821
5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-1,2,4-triazole (PubChem CID 172853821) has the molecular formula C6H2F9N3 and a molecular weight of 287.09 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-1,2,4-triazole.
| Compound Name | 5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 172853821 |
| Molecular Formula | C6H2F9N3 |
| Molecular Weight | 287.09 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-1,2,4-triazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ncn[nH]1 |
| InChI | InChI=1S/C6H2F9N3/c7-3(8,2-16-1-17-18-2)4(9,10)5(11,12)6(13,14)15/h1H,(H,16,17,18) |
| InChIKey | YKTATRCIBCVNFK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.09 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|