C8H2F12N2 — CID 45074915
3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-(trifluoromethyl)-1H-pyrazole (PubChem CID 45074915) has the molecular formula C8H2F12N2 and a molecular weight of 354.09 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-(trifluoromethyl)-1H-pyrazole.
| Compound Name | 3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-(trifluoromethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 45074915 |
| Molecular Formula | C8H2F12N2 |
| Molecular Weight | 354.09 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-(trifluoromethyl)-1H-pyrazole |
| SMILES | FC(F)(F)c1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C8H2F12N2/c9-4(10,2-1-3(22-21-2)5(11,12)13)6(14,15)7(16,17)8(18,19)20/h1H,(H,21,22) |
| InChIKey | MWWFPMSATDOKQQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.09 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|