About ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine
ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (PubChem CID 158678691) has the molecular formula C9H6F3N3Ru
and a molecular weight of 314.23 g/mol. Its IUPAC name is ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
Molecular Properties
| Compound Name | ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| PubChem CID | 158678691 |
| Molecular Formula | C9H6F3N3Ru |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| SMILES | FC(F)(F)c1cc(-c2ccccn2)n[nH]1.[Ru] |
| InChI | InChI=1S/C9H6F3N3.Ru/c10-9(11,12)8-5-7(14-15-8)6-3-1-2-4-13-6;/h1-5H,(H,14,15); |
| InChIKey | IEVOGRKARBAFJY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The IUPAC name of ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (CID 158678691) is ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
What is the SMILES notation for ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The canonical SMILES for ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine is FC(F)(F)c1cc(-c2ccccn2)n[nH]1.[Ru].
What is the InChIKey of ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The InChIKey is IEVOGRKARBAFJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F3N3.Ru/c10-9(11,12)8-5-7(14-15-8)6-3-1-2-4-13-6;/h1-5H,(H,14,15);.
What are the key properties of ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine has a molecular weight of 314.23 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ruthenium;2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine is sourced from PubChem (CID 158678691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).