C10H6F3N3O — CID 113241920
4-pyridin-2-yl-6-(trifluoromethyl)-1H-pyrimidin-2-one (PubChem CID 113241920) has the molecular formula C10H6F3N3O and a molecular weight of 241.17 g/mol. Its IUPAC name is 4-pyridin-2-yl-6-(trifluoromethyl)-1H-pyrimidin-2-one.
| Compound Name | 4-pyridin-2-yl-6-(trifluoromethyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 113241920 |
| Molecular Formula | C10H6F3N3O |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 4-pyridin-2-yl-6-(trifluoromethyl)-1H-pyrimidin-2-one |
| SMILES | O=c1nc(-c2ccccn2)cc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C10H6F3N3O/c11-10(12,13)8-5-7(15-9(17)16-8)6-3-1-2-4-14-6/h1-5H,(H,15,16,17) |
| InChIKey | TUKZTCFUECOEMS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |