C11H6F6N2 — CID 20807365
2-[4,5-bis(trifluoromethyl)-1H-pyrrol-2-yl]pyridine (PubChem CID 20807365) has the molecular formula C11H6F6N2 and a molecular weight of 280.17 g/mol. Its IUPAC name is 2-[4,5-bis(trifluoromethyl)-1H-pyrrol-2-yl]pyridine.
| Compound Name | 2-[4,5-bis(trifluoromethyl)-1H-pyrrol-2-yl]pyridine |
|---|---|
| PubChem CID | 20807365 |
| Molecular Formula | C11H6F6N2 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-[4,5-bis(trifluoromethyl)-1H-pyrrol-2-yl]pyridine |
| SMILES | FC(F)(F)c1cc(-c2ccccn2)[nH]c1C(F)(F)F |
| InChI | InChI=1S/C11H6F6N2/c12-10(13,14)6-5-8(7-3-1-2-4-18-7)19-9(6)11(15,16)17/h1-5,19H |
| InChIKey | WOESXKIVCVTSNK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |