C14H9F6N — CID 144740114
2-[2-methyl-3,5-bis(trifluoromethyl)phenyl]pyridine (PubChem CID 144740114) has the molecular formula C14H9F6N and a molecular weight of 305.22 g/mol. Its IUPAC name is 2-[2-methyl-3,5-bis(trifluoromethyl)phenyl]pyridine.
| Compound Name | 2-[2-methyl-3,5-bis(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 144740114 |
| Molecular Formula | C14H9F6N |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[2-methyl-3,5-bis(trifluoromethyl)phenyl]pyridine |
| SMILES | Cc1c(-c2ccccn2)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C14H9F6N/c1-8-10(12-4-2-3-5-21-12)6-9(13(15,16)17)7-11(8)14(18,19)20/h2-7H,1H3 |
| InChIKey | YIIKFXFQZZMJBJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |