C20H13F6N — CID 58939585
2-[2-[2-methyl-4,6-bis(trifluoromethyl)phenyl]phenyl]pyridine (PubChem CID 58939585) has the molecular formula C20H13F6N and a molecular weight of 381.32 g/mol. Its IUPAC name is 2-[2-[2-methyl-4,6-bis(trifluoromethyl)phenyl]phenyl]pyridine.
| Compound Name | 2-[2-[2-methyl-4,6-bis(trifluoromethyl)phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 58939585 |
| Molecular Formula | C20H13F6N |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-[2-[2-methyl-4,6-bis(trifluoromethyl)phenyl]phenyl]pyridine |
| SMILES | Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1-c1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C20H13F6N/c1-12-10-13(19(21,22)23)11-16(20(24,25)26)18(12)15-7-3-2-6-14(15)17-8-4-5-9-27-17/h2-11H,1H3 |
| InChIKey | HOTINJAFMDVQJK-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |