C19H18N2 — CID 140909024
2-(2,4,6-trimethyl-3-pyridin-2-ylphenyl)pyridine (PubChem CID 140909024) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-(2,4,6-trimethyl-3-pyridin-2-ylphenyl)pyridine.
| Compound Name | 2-(2,4,6-trimethyl-3-pyridin-2-ylphenyl)pyridine |
|---|---|
| PubChem CID | 140909024 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2-(2,4,6-trimethyl-3-pyridin-2-ylphenyl)pyridine |
| SMILES | Cc1cc(C)c(-c2ccccn2)c(C)c1-c1ccccn1 |
| InChI | InChI=1S/C19H18N2/c1-13-12-14(2)19(17-9-5-7-11-21-17)15(3)18(13)16-8-4-6-10-20-16/h4-12H,1-3H3 |
| InChIKey | QUUQSADOLCLYBH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |