C13H14N2 — CID 165495051
3,4-dimethyl-5-pyridin-2-ylaniline (PubChem CID 165495051) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 3,4-dimethyl-5-pyridin-2-ylaniline.
| Compound Name | 3,4-dimethyl-5-pyridin-2-ylaniline |
|---|---|
| PubChem CID | 165495051 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 3,4-dimethyl-5-pyridin-2-ylaniline |
| SMILES | Cc1cc(N)cc(-c2ccccn2)c1C |
| InChI | InChI=1S/C13H14N2/c1-9-7-11(14)8-12(10(9)2)13-5-3-4-6-15-13/h3-8H,14H2,1-2H3 |
| InChIKey | VYTZGDKKPBCIBG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|