C35H33N — CID 140795086
2-[2,3,4-tris(2,3-dimethylphenyl)phenyl]pyridine (PubChem CID 140795086) has the molecular formula C35H33N and a molecular weight of 467.66 g/mol. Its IUPAC name is 2-[2,3,4-tris(2,3-dimethylphenyl)phenyl]pyridine.
| Compound Name | 2-[2,3,4-tris(2,3-dimethylphenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 140795086 |
| Molecular Formula | C35H33N |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 2-[2,3,4-tris(2,3-dimethylphenyl)phenyl]pyridine |
| SMILES | Cc1cccc(-c2ccc(-c3ccccn3)c(-c3cccc(C)c3C)c2-c2cccc(C)c2C)c1C |
| InChI | InChI=1S/C35H33N/c1-22-12-9-15-28(25(22)4)31-19-20-32(33-18-7-8-21-36-33)35(30-17-11-14-24(3)27(30)6)34(31)29-16-10-13-23(2)26(29)5/h7-21H,1-6H3 |
| InChIKey | GLLVZSKFLQNLGG-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |