C5H2F6N2Na — CID 175902898
CID 175902898 (PubChem CID 175902898) has the molecular formula C5H2F6N2Na and a molecular weight of 227.06 g/mol.
| Compound Name | CID 175902898 |
|---|---|
| PubChem CID | 175902898 |
| Molecular Formula | C5H2F6N2Na |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)[nH]n1.[Na] |
| InChI | InChI=1S/C5H2F6N2.Na/c6-4(7,8)2-1-3(13-12-2)5(9,10)11;/h1H,(H,12,13); |
| InChIKey | SXXVUJNDRGPNPD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |