C11H9F3N2O — CID 142636961
[4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]methanol (PubChem CID 142636961) has the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. Its IUPAC name is [4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]methanol.
| Compound Name | [4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 142636961 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | [4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]methanol |
| SMILES | OCc1ccc(-c2cc(C(F)(F)F)[nH]n2)cc1 |
| InChI | InChI=1S/C11H9F3N2O/c12-11(13,14)10-5-9(15-16-10)8-3-1-7(6-17)2-4-8/h1-5,17H,6H2,(H,15,16) |
| InChIKey | KEUAWBJETQYUQA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |