C12H9F3N2O3 — CID 136609734
methyl 2-hydroxy-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]benzoate (PubChem CID 136609734) has the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. Its IUPAC name is methyl 2-hydroxy-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]benzoate.
| Compound Name | methyl 2-hydroxy-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]benzoate |
|---|---|
| PubChem CID | 136609734 |
| Molecular Formula | C12H9F3N2O3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | methyl 2-hydroxy-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]benzoate |
| SMILES | COC(=O)c1cc(-c2cc(C(F)(F)F)[nH]n2)ccc1O |
| InChI | InChI=1S/C12H9F3N2O3/c1-20-11(19)7-4-6(2-3-9(7)18)8-5-10(17-16-8)12(13,14)15/h2-5,18H,1H3,(H,16,17) |
| InChIKey | VZGDAHSBTUIAPX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |