C7H5F3N2O3 — CID 131255256
methyl 6-oxo-3-(trifluoromethyl)-1H-pyridazine-5-carboxylate (PubChem CID 131255256) has the molecular formula C7H5F3N2O3 and a molecular weight of 222.12 g/mol. Its IUPAC name is methyl 6-oxo-3-(trifluoromethyl)-1H-pyridazine-5-carboxylate.
| Compound Name | methyl 6-oxo-3-(trifluoromethyl)-1H-pyridazine-5-carboxylate |
|---|---|
| PubChem CID | 131255256 |
| Molecular Formula | C7H5F3N2O3 |
| Molecular Weight | 222.12 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | methyl 6-oxo-3-(trifluoromethyl)-1H-pyridazine-5-carboxylate |
| SMILES | COC(=O)c1cc(C(F)(F)F)n[nH]c1=O |
| InChI | InChI=1S/C7H5F3N2O3/c1-15-6(14)3-2-4(7(8,9)10)11-12-5(3)13/h2H,1H3,(H,12,13) |
| InChIKey | MGESAAUJGIIVAT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.12 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |