C10H14F3N3O2 — CID 59637276
tert-butyl N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]carbamate (PubChem CID 59637276) has the molecular formula C10H14F3N3O2 and a molecular weight of 265.23 g/mol. Its IUPAC name is tert-butyl N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 59637276 |
| Molecular Formula | C10H14F3N3O2 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | tert-butyl N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C10H14F3N3O2/c1-9(2,3)18-8(17)14-5-6-4-7(16-15-6)10(11,12)13/h4H,5H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | WORPWOGJWQFGHU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |