C12H16F3N3O2 — CID 122536420
tert-butyl N-[[2-amino-6-(trifluoromethyl)-4-pyridinyl]methyl]carbamate (PubChem CID 122536420) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is tert-butyl N-[[2-amino-6-(trifluoromethyl)-4-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-amino-6-(trifluoromethyl)-4-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 122536420 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | tert-butyl N-[[2-amino-6-(trifluoromethyl)-4-pyridinyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(N)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3N3O2/c1-11(2,3)20-10(19)17-6-7-4-8(12(13,14)15)18-9(16)5-7/h4-5H,6H2,1-3H3,(H2,16,18)(H,17,19) |
| InChIKey | LDLMPDZUNQDTOO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |