C10H12F3N5 — CID 19626471
1-ethyl-N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]pyrazol-4-amine (PubChem CID 19626471) has the molecular formula C10H12F3N5 and a molecular weight of 259.24 g/mol. Its IUPAC name is 1-ethyl-N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]pyrazol-4-amine.
| Compound Name | 1-ethyl-N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]pyrazol-4-amine |
|---|---|
| PubChem CID | 19626471 |
| Molecular Formula | C10H12F3N5 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-ethyl-N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]pyrazol-4-amine |
| SMILES | CCn1cc(NCc2cc(C(F)(F)F)n[nH]2)cn1 |
| InChI | InChI=1S/C10H12F3N5/c1-2-18-6-8(5-15-18)14-4-7-3-9(17-16-7)10(11,12)13/h3,5-6,14H,2,4H2,1H3,(H,16,17) |
| InChIKey | VHMWPHOWNLFXJD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |