C11H14F3N5 — CID 19625478
N-[(1-ethylpyrazol-4-yl)methyl]-1-[3-(trifluoromethyl)-1H-pyrazol-5-yl]methanamine (PubChem CID 19625478) has the molecular formula C11H14F3N5 and a molecular weight of 273.26 g/mol. Its IUPAC name is N-[(1-ethylpyrazol-4-yl)methyl]-1-[3-(trifluoromethyl)-1H-pyrazol-5-yl]methanamine.
| Compound Name | N-[(1-ethylpyrazol-4-yl)methyl]-1-[3-(trifluoromethyl)-1H-pyrazol-5-yl]methanamine |
|---|---|
| PubChem CID | 19625478 |
| Molecular Formula | C11H14F3N5 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-[(1-ethylpyrazol-4-yl)methyl]-1-[3-(trifluoromethyl)-1H-pyrazol-5-yl]methanamine |
| SMILES | CCn1cc(CNCc2cc(C(F)(F)F)n[nH]2)cn1 |
| InChI | InChI=1S/C11H14F3N5/c1-2-19-7-8(5-16-19)4-15-6-9-3-10(18-17-9)11(12,13)14/h3,5,7,15H,2,4,6H2,1H3,(H,17,18) |
| InChIKey | SIQSOYFFAONBIB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |