C11H16F3N3O2 — CID 546504
tert-butyl N-[2-[2-(trifluoromethyl)-1H-imidazol-5-yl]ethyl]carbamate (PubChem CID 546504) has the molecular formula C11H16F3N3O2 and a molecular weight of 279.26 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(trifluoromethyl)-1H-imidazol-5-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(trifluoromethyl)-1H-imidazol-5-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 546504 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | tert-butyl N-[2-[2-(trifluoromethyl)-1H-imidazol-5-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cnc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C11H16F3N3O2/c1-10(2,3)19-9(18)15-5-4-7-6-16-8(17-7)11(12,13)14/h6H,4-5H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | YBVZMAVMWQMCLF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |