C9H7F4NO4 — CID 134680790
methyl 6-(fluoromethyl)-2-oxo-5-(trifluoromethoxy)-1H-pyridine-3-carboxylate (PubChem CID 134680790) has the molecular formula C9H7F4NO4 and a molecular weight of 269.15 g/mol. Its IUPAC name is methyl 6-(fluoromethyl)-2-oxo-5-(trifluoromethoxy)-1H-pyridine-3-carboxylate.
| Compound Name | methyl 6-(fluoromethyl)-2-oxo-5-(trifluoromethoxy)-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134680790 |
| Molecular Formula | C9H7F4NO4 |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | methyl 6-(fluoromethyl)-2-oxo-5-(trifluoromethoxy)-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(OC(F)(F)F)c(CF)[nH]c1=O |
| InChI | InChI=1S/C9H7F4NO4/c1-17-8(16)4-2-6(18-9(11,12)13)5(3-10)14-7(4)15/h2H,3H2,1H3,(H,14,15) |
| InChIKey | QGOOGRNETRPYLE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |