C9H5Br2F3O3 — CID 18925647
methyl 2,4-dibromo-5-(trifluoromethoxy)benzoate (PubChem CID 18925647) has the molecular formula C9H5Br2F3O3 and a molecular weight of 377.94 g/mol. Its IUPAC name is methyl 2,4-dibromo-5-(trifluoromethoxy)benzoate.
| Compound Name | methyl 2,4-dibromo-5-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 18925647 |
| Molecular Formula | C9H5Br2F3O3 |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 375.86 |
| IUPAC Name | methyl 2,4-dibromo-5-(trifluoromethoxy)benzoate |
| SMILES | COC(=O)c1cc(OC(F)(F)F)c(Br)cc1Br |
| InChI | InChI=1S/C9H5Br2F3O3/c1-16-8(15)4-2-7(17-9(12,13)14)6(11)3-5(4)10/h2-3H,1H3 |
| InChIKey | GNLUCPZNGBTKOX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |