C15H12F3N5O4 — CID 155903294
4-hydroxy-2,6-dioxo-N-[4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]-1,3-diazinane-5-carboxamide (PubChem CID 155903294) has the molecular formula C15H12F3N5O4 and a molecular weight of 383.29 g/mol. Its IUPAC name is 4-hydroxy-2,6-dioxo-N-[4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]-1,3-diazinane-5-carboxamide.
| Compound Name | 4-hydroxy-2,6-dioxo-N-[4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 155903294 |
| Molecular Formula | C15H12F3N5O4 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 4-hydroxy-2,6-dioxo-N-[4-[5-(trifluoromethyl)-1H-pyrazol-3-yl]phenyl]-1,3-diazinane-5-carboxamide |
| SMILES | O=C1NC(=O)C(C(=O)Nc2ccc(-c3cc(C(F)(F)F)[nH]n3)cc2)C(O)N1 |
| InChI | InChI=1S/C15H12F3N5O4/c16-15(17,18)9-5-8(22-23-9)6-1-3-7(4-2-6)19-11(24)10-12(25)20-14(27)21-13(10)26/h1-5,10,12,25H,(H,19,24)(H,22,23)(H2,20,21,26,27) |
| InChIKey | WOTMUBAGWOWZLC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|