C13H12N6O4 — CID 155903283
4-hydroxy-2,6-dioxo-N-[3-(2H-triazol-4-yl)phenyl]-1,3-diazinane-5-carboxamide (PubChem CID 155903283) has the molecular formula C13H12N6O4 and a molecular weight of 316.28 g/mol. Its IUPAC name is 4-hydroxy-2,6-dioxo-N-[3-(2H-triazol-4-yl)phenyl]-1,3-diazinane-5-carboxamide.
| Compound Name | 4-hydroxy-2,6-dioxo-N-[3-(2H-triazol-4-yl)phenyl]-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 155903283 |
| Molecular Formula | C13H12N6O4 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-hydroxy-2,6-dioxo-N-[3-(2H-triazol-4-yl)phenyl]-1,3-diazinane-5-carboxamide |
| SMILES | O=C1NC(=O)C(C(=O)Nc2cccc(-c3cn[nH]n3)c2)C(O)N1 |
| InChI | InChI=1S/C13H12N6O4/c20-10(9-11(21)16-13(23)17-12(9)22)15-7-3-1-2-6(4-7)8-5-14-19-18-8/h1-5,9,11,21H,(H,15,20)(H,14,18,19)(H2,16,17,22,23) |
| InChIKey | BYXLSAISCNJIPM-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 149.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|