C9H15F3N2O — CID 176568789
ethane;5-(ethoxymethyl)-3-(trifluoromethyl)-1H-pyrazole (PubChem CID 176568789) has the molecular formula C9H15F3N2O and a molecular weight of 224.23 g/mol. Its IUPAC name is ethane;5-(ethoxymethyl)-3-(trifluoromethyl)-1H-pyrazole.
| Compound Name | ethane;5-(ethoxymethyl)-3-(trifluoromethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 176568789 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | ethane;5-(ethoxymethyl)-3-(trifluoromethyl)-1H-pyrazole |
| SMILES | CC.CCOCc1cc(C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C7H9F3N2O.C2H6/c1-2-13-4-5-3-6(12-11-5)7(8,9)10;1-2/h3H,2,4H2,1H3,(H,11,12);1-2H3 |
| InChIKey | MITOXKWMQHIOLF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |