C16H4F18N4 — CID 176747479
2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-[5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrazin-2-yl]pyrazine (PubChem CID 176747479) has the molecular formula C16H4F18N4 and a molecular weight of 594.20 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-[5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrazin-2-yl]pyrazine.
| Compound Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-[5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrazin-2-yl]pyrazine |
|---|---|
| PubChem CID | 176747479 |
| Molecular Formula | C16H4F18N4 |
| Molecular Weight | 594.20 g/mol |
| Exact Mass | 594.01 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-[5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrazin-2-yl]pyrazine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)c1cnc(-c2cnc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cn2)cn1 |
| InChI | InChI=1S/C16H4F18N4/c17-9(18,11(21,22)13(25,26)15(29,30)31)7-3-35-5(1-37-7)6-2-38-8(4-36-6)10(19,20)12(23,24)14(27,28)16(32,33)34/h1-4H |
| InChIKey | HXMQMTSJBQZXIU-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.20 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|