C11H8F13N3 — CID 171588092
1-propan-2-yl-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)triazole (PubChem CID 171588092) has the molecular formula C11H8F13N3 and a molecular weight of 429.18 g/mol. Its IUPAC name is 1-propan-2-yl-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)triazole.
| Compound Name | 1-propan-2-yl-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)triazole |
|---|---|
| PubChem CID | 171588092 |
| Molecular Formula | C11H8F13N3 |
| Molecular Weight | 429.18 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 1-propan-2-yl-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)triazole |
| SMILES | CC(C)n1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nn1 |
| InChI | InChI=1S/C11H8F13N3/c1-4(2)27-3-5(25-26-27)6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h3-4H,1-2H3 |
| InChIKey | DXBOOIDUHXCQQX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.18 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|