C10H17ClN4O — CID 166406372
2-chloro-N-[2-(1-propan-2-yltriazol-4-yl)propan-2-yl]acetamide (PubChem CID 166406372) has the molecular formula C10H17ClN4O and a molecular weight of 244.73 g/mol. Its IUPAC name is 2-chloro-N-[2-(1-propan-2-yltriazol-4-yl)propan-2-yl]acetamide.
| Compound Name | 2-chloro-N-[2-(1-propan-2-yltriazol-4-yl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 166406372 |
| Molecular Formula | C10H17ClN4O |
| Molecular Weight | 244.73 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-chloro-N-[2-(1-propan-2-yltriazol-4-yl)propan-2-yl]acetamide |
| SMILES | CC(C)n1cc(C(C)(C)NC(=O)CCl)nn1 |
| InChI | InChI=1S/C10H17ClN4O/c1-7(2)15-6-8(13-14-15)10(3,4)12-9(16)5-11/h6-7H,5H2,1-4H3,(H,12,16) |
| InChIKey | BUGDRICSULKIKY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.73 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|