C7H4F7N3 — CID 89445361
5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pyrazin-2-amine (PubChem CID 89445361) has the molecular formula C7H4F7N3 and a molecular weight of 263.12 g/mol. Its IUPAC name is 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pyrazin-2-amine.
| Compound Name | 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 89445361 |
| Molecular Formula | C7H4F7N3 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pyrazin-2-amine |
| SMILES | Nc1cnc(C(F)(C(F)(F)F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C7H4F7N3/c8-5(6(9,10)11,7(12,13)14)3-1-17-4(15)2-16-3/h1-2H,(H2,15,17) |
| InChIKey | GFVJDANTDSLBJN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |