C5HF6N3 — CID 170294965
3,6-bis(trifluoromethyl)-1,2,4-triazine (PubChem CID 170294965) has the molecular formula C5HF6N3 and a molecular weight of 217.07 g/mol. Its IUPAC name is 3,6-bis(trifluoromethyl)-1,2,4-triazine.
| Compound Name | 3,6-bis(trifluoromethyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 170294965 |
| Molecular Formula | C5HF6N3 |
| Molecular Weight | 217.07 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 3,6-bis(trifluoromethyl)-1,2,4-triazine |
| SMILES | FC(F)(F)c1cnc(C(F)(F)F)nn1 |
| InChI | InChI=1S/C5HF6N3/c6-4(7,8)2-1-12-3(14-13-2)5(9,10)11/h1H |
| InChIKey | YHOUOJDKKOGLGG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.07 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |