C8H5F9N2 — CID 2775813
5-methyl-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-pyrazole (PubChem CID 2775813) has the molecular formula C8H5F9N2 and a molecular weight of 300.12 g/mol. Its IUPAC name is 5-methyl-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-pyrazole.
| Compound Name | 5-methyl-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-pyrazole |
|---|---|
| PubChem CID | 2775813 |
| Molecular Formula | C8H5F9N2 |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 5-methyl-3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-pyrazole |
| SMILES | Cc1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C8H5F9N2/c1-3-2-4(19-18-3)5(9,10)6(11,12)7(13,14)8(15,16)17/h2H,1H3,(H,18,19) |
| InChIKey | UEWLDKAYGDLRGH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|