C16H7F13N2O — CID 136852890
2-phenyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrimidin-6-one (PubChem CID 136852890) has the molecular formula C16H7F13N2O and a molecular weight of 490.22 g/mol. Its IUPAC name is 2-phenyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrimidin-6-one.
| Compound Name | 2-phenyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136852890 |
| Molecular Formula | C16H7F13N2O |
| Molecular Weight | 490.22 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | 2-phenyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C16H7F13N2O/c17-11(18,8-6-9(32)31-10(30-8)7-4-2-1-3-5-7)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h1-6H,(H,30,31,32) |
| InChIKey | SVYJOLWYONBFQI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.22 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|