C18H10F7N — CID 164677987
2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-phenylquinoline (PubChem CID 164677987) has the molecular formula C18H10F7N and a molecular weight of 373.27 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-phenylquinoline.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-phenylquinoline |
|---|---|
| PubChem CID | 164677987 |
| Molecular Formula | C18H10F7N |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-phenylquinoline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1cc(-c2ccccc2)c2ccccc2n1 |
| InChI | InChI=1S/C18H10F7N/c19-16(20,17(21,22)18(23,24)25)15-10-13(11-6-2-1-3-7-11)12-8-4-5-9-14(12)26-15/h1-10H |
| InChIKey | BKHXADSFLCPAEN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|