C17H10F7N — CID 102237067
6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylphenanthridine (PubChem CID 102237067) has the molecular formula C17H10F7N and a molecular weight of 361.26 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylphenanthridine.
| Compound Name | 6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylphenanthridine |
|---|---|
| PubChem CID | 102237067 |
| Molecular Formula | C17H10F7N |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-methylphenanthridine |
| SMILES | Cc1ccc2nc(C(F)(F)C(F)(F)C(F)(F)F)c3ccccc3c2c1 |
| InChI | InChI=1S/C17H10F7N/c1-9-6-7-13-12(8-9)10-4-2-3-5-11(10)14(25-13)15(18,19)16(20,21)17(22,23)24/h2-8H,1H3 |
| InChIKey | FQLLCCNXEZYHBY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|