C10H4Cl2F3N3O — CID 135794340
2-(2,6-dichloro-4-pyridinyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 135794340) has the molecular formula C10H4Cl2F3N3O and a molecular weight of 310.06 g/mol. Its IUPAC name is 2-(2,6-dichloro-4-pyridinyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(2,6-dichloro-4-pyridinyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135794340 |
| Molecular Formula | C10H4Cl2F3N3O |
| Molecular Weight | 310.06 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | 2-(2,6-dichloro-4-pyridinyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(F)(F)F)nc(-c2cc(Cl)nc(Cl)c2)[nH]1 |
| InChI | InChI=1S/C10H4Cl2F3N3O/c11-6-1-4(2-7(12)17-6)9-16-5(10(13,14)15)3-8(19)18-9/h1-3H,(H,16,18,19) |
| InChIKey | GBUQWAWFSGSYHK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.06 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|