C12H7F7N2 — CID 2774948
5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1H-pyrazole (PubChem CID 2774948) has the molecular formula C12H7F7N2 and a molecular weight of 312.19 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1H-pyrazole.
| Compound Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1H-pyrazole |
|---|---|
| PubChem CID | 2774948 |
| Molecular Formula | C12H7F7N2 |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1H-pyrazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C12H7F7N2/c13-10(14,11(15,16)12(17,18)19)9-6-8(20-21-9)7-4-2-1-3-5-7/h1-6H,(H,20,21) |
| InChIKey | JZKFJUIBEKMWRF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|