C9H17N3 — CID 164943779
5-(2,3,3-trimethylbutan-2-yl)-1H-1,2,4-triazole (PubChem CID 164943779) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 5-(2,3,3-trimethylbutan-2-yl)-1H-1,2,4-triazole.
| Compound Name | 5-(2,3,3-trimethylbutan-2-yl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 164943779 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 5-(2,3,3-trimethylbutan-2-yl)-1H-1,2,4-triazole |
| SMILES | CC(C)(C)C(C)(C)c1ncn[nH]1 |
| InChI | InChI=1S/C9H17N3/c1-8(2,3)9(4,5)7-10-6-11-12-7/h6H,1-5H3,(H,10,11,12) |
| InChIKey | ZTNOQFXITNLFRY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |