C6H11N5O — CID 166001834
tert-butylimino-oxido-(1H-1,2,4-triazol-5-yl)azanium (PubChem CID 166001834) has the molecular formula C6H11N5O and a molecular weight of 169.19 g/mol. Its IUPAC name is tert-butylimino-oxido-(1H-1,2,4-triazol-5-yl)azanium.
| Compound Name | tert-butylimino-oxido-(1H-1,2,4-triazol-5-yl)azanium |
|---|---|
| PubChem CID | 166001834 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | tert-butylimino-oxido-(1H-1,2,4-triazol-5-yl)azanium |
| SMILES | CC(C)(C)/N=[N+](\[O-])c1ncn[nH]1 |
| InChI | InChI=1S/C6H11N5O/c1-6(2,3)10-11(12)5-7-4-8-9-5/h4H,1-3H3,(H,7,8,9)/b11-10- |
| InChIKey | NWUMXBURVRZYOX-KHPPLWFESA-N |
| XLogP | 1.20 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|