C4H7N5 — CID 135965193
N'-methyl-1H-1,2,4-triazole-5-carboximidamide (PubChem CID 135965193) has the molecular formula C4H7N5 and a molecular weight of 125.13 g/mol. Its IUPAC name is N'-methyl-1H-1,2,4-triazole-5-carboximidamide.
| Compound Name | N'-methyl-1H-1,2,4-triazole-5-carboximidamide |
|---|---|
| PubChem CID | 135965193 |
| Molecular Formula | C4H7N5 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.07 |
| IUPAC Name | N'-methyl-1H-1,2,4-triazole-5-carboximidamide |
| SMILES | C/N=C(\N)c1ncn[nH]1 |
| InChI | InChI=1S/C4H7N5/c1-6-3(5)4-7-2-8-9-4/h2H,1H3,(H2,5,6)(H,7,8,9) |
| InChIKey | DLJPXOURMAVMGX-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|