C6H9N5 — CID 135965177
N'-cyclopropyl-1H-1,2,4-triazole-5-carboximidamide (PubChem CID 135965177) has the molecular formula C6H9N5 and a molecular weight of 151.17 g/mol. Its IUPAC name is N'-cyclopropyl-1H-1,2,4-triazole-5-carboximidamide.
| Compound Name | N'-cyclopropyl-1H-1,2,4-triazole-5-carboximidamide |
|---|---|
| PubChem CID | 135965177 |
| Molecular Formula | C6H9N5 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | N'-cyclopropyl-1H-1,2,4-triazole-5-carboximidamide |
| SMILES | N/C(=N\C1CC1)c1ncn[nH]1 |
| InChI | InChI=1S/C6H9N5/c7-5(10-4-1-2-4)6-8-3-9-11-6/h3-4H,1-2H2,(H2,7,10)(H,8,9,11) |
| InChIKey | JVAGHNHXPFSHPB-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|