C13H20N6O4 — CID 175284797
[4-oxo-4-[4-(1H-1,2,4-triazole-5-carbonylamino)piperidin-1-yl]butyl] carbamate (PubChem CID 175284797) has the molecular formula C13H20N6O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is [4-oxo-4-[4-(1H-1,2,4-triazole-5-carbonylamino)piperidin-1-yl]butyl] carbamate.
| Compound Name | [4-oxo-4-[4-(1H-1,2,4-triazole-5-carbonylamino)piperidin-1-yl]butyl] carbamate |
|---|---|
| PubChem CID | 175284797 |
| Molecular Formula | C13H20N6O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [4-oxo-4-[4-(1H-1,2,4-triazole-5-carbonylamino)piperidin-1-yl]butyl] carbamate |
| SMILES | NC(=O)OCCCC(=O)N1CCC(NC(=O)c2ncn[nH]2)CC1 |
| InChI | InChI=1S/C13H20N6O4/c14-13(22)23-7-1-2-10(20)19-5-3-9(4-6-19)17-12(21)11-15-8-16-18-11/h8-9H,1-7H2,(H2,14,22)(H,17,21)(H,15,16,18) |
| InChIKey | IREDGVKNOQXHTK-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|