C9H14N4O — CID 130556518
N-(2,2-dimethylcyclobutyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 130556518) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is N-(2,2-dimethylcyclobutyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(2,2-dimethylcyclobutyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 130556518 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N-(2,2-dimethylcyclobutyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CC1(C)CCC1NC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C9H14N4O/c1-9(2)4-3-6(9)12-8(14)7-10-5-11-13-7/h5-6H,3-4H2,1-2H3,(H,12,14)(H,10,11,13) |
| InChIKey | BJPRZMZVXCMJPU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |