C7H10N4O2 — CID 178044684
N-[(3R)-oxolan-3-yl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 178044684) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is N-[(3R)-oxolan-3-yl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[(3R)-oxolan-3-yl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 178044684 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | N-[(3R)-oxolan-3-yl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(N[C@@H]1CCOC1)c1ncn[nH]1 |
| InChI | InChI=1S/C7H10N4O2/c12-7(6-8-4-9-11-6)10-5-1-2-13-3-5/h4-5H,1-3H2,(H,10,12)(H,8,9,11)/t5-/m1/s1 |
| InChIKey | NPAKEAGVOSEACS-RXMQYKEDSA-N |
| XLogP | -0.68 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |