C12H20N4O — CID 2914105
N-(3,3,5-trimethylcyclohexyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 2914105) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is N-(3,3,5-trimethylcyclohexyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(3,3,5-trimethylcyclohexyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 2914105 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | N-(3,3,5-trimethylcyclohexyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CC1CC(NC(=O)c2ncn[nH]2)CC(C)(C)C1 |
| InChI | InChI=1S/C12H20N4O/c1-8-4-9(6-12(2,3)5-8)15-11(17)10-13-7-14-16-10/h7-9H,4-6H2,1-3H3,(H,15,17)(H,13,14,16) |
| InChIKey | FZDGDQZXMLTTGG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |