C19H29NO4 — CID 673811
3,4,5-trimethoxy-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]benzamide (PubChem CID 673811) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 673811 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]benzamide |
| SMILES | COc1cc(C(=O)N[C@H]2C[C@H](C)CC(C)(C)C2)cc(OC)c1OC |
| InChI | InChI=1S/C19H29NO4/c1-12-7-14(11-19(2,3)10-12)20-18(21)13-8-15(22-4)17(24-6)16(9-13)23-5/h8-9,12,14H,7,10-11H2,1-6H3,(H,20,21)/t12-,14-/m0/s1 |
| InChIKey | DFMOVWZOPBXSMW-JSGCOSHPSA-N |
| XLogP | 3.66 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |