C18H27NO2S — CID 43926556
2-methoxy-4-methylsulfanyl-N-(3,3,5-trimethylcyclohexyl)benzamide (PubChem CID 43926556) has the molecular formula C18H27NO2S and a molecular weight of 321.49 g/mol. Its IUPAC name is 2-methoxy-4-methylsulfanyl-N-(3,3,5-trimethylcyclohexyl)benzamide.
| Compound Name | 2-methoxy-4-methylsulfanyl-N-(3,3,5-trimethylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 43926556 |
| Molecular Formula | C18H27NO2S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-methoxy-4-methylsulfanyl-N-(3,3,5-trimethylcyclohexyl)benzamide |
| SMILES | COc1cc(SC)ccc1C(=O)NC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C18H27NO2S/c1-12-8-13(11-18(2,3)10-12)19-17(20)15-7-6-14(22-5)9-16(15)21-4/h6-7,9,12-13H,8,10-11H2,1-5H3,(H,19,20) |
| InChIKey | SEAVOIJIMCQATK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |