C16H21Cl2NO — CID 673817
2,4-dichloro-N-[(1S,5S)-3,3,5-trimethylcyclohexyl]benzamide (PubChem CID 673817) has the molecular formula C16H21Cl2NO and a molecular weight of 314.26 g/mol. Its IUPAC name is 2,4-dichloro-N-[(1S,5S)-3,3,5-trimethylcyclohexyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(1S,5S)-3,3,5-trimethylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 673817 |
| Molecular Formula | C16H21Cl2NO |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2,4-dichloro-N-[(1S,5S)-3,3,5-trimethylcyclohexyl]benzamide |
| SMILES | C[C@@H]1C[C@H](NC(=O)c2ccc(Cl)cc2Cl)CC(C)(C)C1 |
| InChI | InChI=1S/C16H21Cl2NO/c1-10-6-12(9-16(2,3)8-10)19-15(20)13-5-4-11(17)7-14(13)18/h4-5,7,10,12H,6,8-9H2,1-3H3,(H,19,20)/t10-,12+/m1/s1 |
| InChIKey | YHYOZFKTRSUULA-PWSUYJOCSA-N |
| XLogP | 4.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |