C17H23ClFNO — CID 103966065
5-chloro-2-fluoro-N-(3,3,5,5-tetramethylcyclohexyl)benzamide (PubChem CID 103966065) has the molecular formula C17H23ClFNO and a molecular weight of 311.83 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-(3,3,5,5-tetramethylcyclohexyl)benzamide.
| Compound Name | 5-chloro-2-fluoro-N-(3,3,5,5-tetramethylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 103966065 |
| Molecular Formula | C17H23ClFNO |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 5-chloro-2-fluoro-N-(3,3,5,5-tetramethylcyclohexyl)benzamide |
| SMILES | CC1(C)CC(NC(=O)c2cc(Cl)ccc2F)CC(C)(C)C1 |
| InChI | InChI=1S/C17H23ClFNO/c1-16(2)8-12(9-17(3,4)10-16)20-15(21)13-7-11(18)5-6-14(13)19/h5-7,12H,8-10H2,1-4H3,(H,20,21) |
| InChIKey | MXFKYWGWJXQAJJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |