C12H13ClFNO — CID 61217679
5-chloro-N-(2,2-dimethylcyclopropyl)-2-fluorobenzamide (PubChem CID 61217679) has the molecular formula C12H13ClFNO and a molecular weight of 241.69 g/mol. Its IUPAC name is 5-chloro-N-(2,2-dimethylcyclopropyl)-2-fluorobenzamide.
| Compound Name | 5-chloro-N-(2,2-dimethylcyclopropyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 61217679 |
| Molecular Formula | C12H13ClFNO |
| Molecular Weight | 241.69 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 5-chloro-N-(2,2-dimethylcyclopropyl)-2-fluorobenzamide |
| SMILES | CC1(C)CC1NC(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C12H13ClFNO/c1-12(2)6-10(12)15-11(16)8-5-7(13)3-4-9(8)14/h3-5,10H,6H2,1-2H3,(H,15,16) |
| InChIKey | ZHZPPSMNZULFID-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.69 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |