C12H14ClFN2O3S — CID 65387287
2-chloro-N-(2,2-dimethylcyclopropyl)-4-fluoro-5-sulfamoylbenzamide (PubChem CID 65387287) has the molecular formula C12H14ClFN2O3S and a molecular weight of 320.77 g/mol. Its IUPAC name is 2-chloro-N-(2,2-dimethylcyclopropyl)-4-fluoro-5-sulfamoylbenzamide.
| Compound Name | 2-chloro-N-(2,2-dimethylcyclopropyl)-4-fluoro-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65387287 |
| Molecular Formula | C12H14ClFN2O3S |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-chloro-N-(2,2-dimethylcyclopropyl)-4-fluoro-5-sulfamoylbenzamide |
| SMILES | CC1(C)CC1NC(=O)c1cc(S(N)(=O)=O)c(F)cc1Cl |
| InChI | InChI=1S/C12H14ClFN2O3S/c1-12(2)5-10(12)16-11(17)6-3-9(20(15,18)19)8(14)4-7(6)13/h3-4,10H,5H2,1-2H3,(H,16,17)(H2,15,18,19) |
| InChIKey | PXPOBNQWZFKKSK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |